C25H25FO6 — CID 46933281
5-[(E)-2-(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenol (PubChem CID 46933281) has the molecular formula C25H25FO6 and a molecular weight of 440.47 g/mol. Its IUPAC name is 5-[(E)-2-(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenol.
| Compound Name | 5-[(E)-2-(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 46933281 |
| Molecular Formula | C25H25FO6 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[(E)-2-(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-methoxyphenol |
| SMILES | COc1ccc(/C=C(/c2ccc(OC)c(F)c2)c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C25H25FO6/c1-28-21-9-7-16(12-19(21)26)18(10-15-6-8-22(29-2)20(27)11-15)17-13-23(30-3)25(32-5)24(14-17)31-4/h6-14,27H,1-5H3/b18-10- |
| InChIKey | GNRHUVUFOOQHQM-ZDLGFXPLSA-N |
| XLogP | 5.16 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|