C23H28N2O6 — CID 155807360
(E)-3-(3-hydroxy-4-methoxyphenyl)-1-piperazin-1-yl-2-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 155807360) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4-methoxyphenyl)-1-piperazin-1-yl-2-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-1-piperazin-1-yl-2-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155807360 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-1-piperazin-1-yl-2-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C(/C(=O)N2CCNCC2)c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C23H28N2O6/c1-28-19-6-5-15(12-18(19)26)11-17(23(27)25-9-7-24-8-10-25)16-13-20(29-2)22(31-4)21(14-16)30-3/h5-6,11-14,24,26H,7-10H2,1-4H3/b17-11+ |
| InChIKey | NIZIKFLHOVXCIV-GZTJUZNOSA-N |
| XLogP | 2.40 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|