C24H22O4 — CID 20991953
(Z)-3-[4-methoxy-2-[(2-methylphenyl)methoxy]phenyl]-2-phenylprop-2-enoic acid (PubChem CID 20991953) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (Z)-3-[4-methoxy-2-[(2-methylphenyl)methoxy]phenyl]-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-[4-methoxy-2-[(2-methylphenyl)methoxy]phenyl]-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 20991953 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (Z)-3-[4-methoxy-2-[(2-methylphenyl)methoxy]phenyl]-2-phenylprop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\C(=O)O)c2ccccc2)c(OCc2ccccc2C)c1 |
| InChI | InChI=1S/C24H22O4/c1-17-8-6-7-11-20(17)16-28-23-15-21(27-2)13-12-19(23)14-22(24(25)26)18-9-4-3-5-10-18/h3-15H,16H2,1-2H3,(H,25,26)/b22-14- |
| InChIKey | YXNBJZGAONYINI-HMAPJEAMSA-N |
| XLogP | 5.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|