C38H45NO7 — CID 101023121
(Z)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-2-[4-(oxan-2-yloxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one (PubChem CID 101023121) has the molecular formula C38H45NO7 and a molecular weight of 627.78 g/mol. Its IUPAC name is (Z)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-2-[4-(oxan-2-yloxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-2-[4-(oxan-2-yloxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 101023121 |
| Molecular Formula | C38H45NO7 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (Z)-1-[2-hydroxy-4-(oxan-2-yloxy)phenyl]-2-[4-(oxan-2-yloxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(OCCN2CCCCC2)cc1)c1ccc(OC2CCCCO2)cc1)c1ccc(OC2CCCCO2)cc1O |
| InChI | InChI=1S/C38H45NO7/c40-35-27-32(46-37-9-3-7-24-44-37)18-19-33(35)38(41)34(29-12-16-31(17-13-29)45-36-8-2-6-23-43-36)26-28-10-14-30(15-11-28)42-25-22-39-20-4-1-5-21-39/h10-19,26-27,36-37,40H,1-9,20-25H2/b34-26- |
| InChIKey | KBPVXLOKFCLMQI-CLIDGEQKSA-N |
| XLogP | 7.49 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|