C37H46N2O6 — CID 138377511
3-[4-[2-(4-cyclohexylpiperazin-1-yl)ethoxy]phenyl]-1,2-bis(3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 138377511) has the molecular formula C37H46N2O6 and a molecular weight of 614.78 g/mol. Its IUPAC name is 3-[4-[2-(4-cyclohexylpiperazin-1-yl)ethoxy]phenyl]-1,2-bis(3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[4-[2-(4-cyclohexylpiperazin-1-yl)ethoxy]phenyl]-1,2-bis(3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 138377511 |
| Molecular Formula | C37H46N2O6 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 3-[4-[2-(4-cyclohexylpiperazin-1-yl)ethoxy]phenyl]-1,2-bis(3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)cc(C(=O)C(=Cc2ccc(OCCN3CCN(C4CCCCC4)CC3)cc2)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C37H46N2O6/c1-41-32-21-28(22-33(25-32)42-2)36(37(40)29-23-34(43-3)26-35(24-29)44-4)20-27-10-12-31(13-11-27)45-19-18-38-14-16-39(17-15-38)30-8-6-5-7-9-30/h10-13,20-26,30H,5-9,14-19H2,1-4H3 |
| InChIKey | NDGNLANKUFQMNC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|