C25H22N2O4S — CID 19498934
furan-2-yl-[4-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 19498934) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is furan-2-yl-[4-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19498934 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | furan-2-yl-[4-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2cc(COc3ccc4ccccc4c3)cs2)CC1 |
| InChI | InChI=1S/C25H22N2O4S/c28-24(22-6-3-13-30-22)26-9-11-27(12-10-26)25(29)23-14-18(17-32-23)16-31-21-8-7-19-4-1-2-5-20(19)15-21/h1-8,13-15,17H,9-12,16H2 |
| InChIKey | JGMZGKHCMXVMHV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |