C24H17N3O3S — CID 19499067
N-[4-(furan-2-yl)pyrimidin-2-yl]-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide (PubChem CID 19499067) has the molecular formula C24H17N3O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[4-(furan-2-yl)pyrimidin-2-yl]-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide.
| Compound Name | N-[4-(furan-2-yl)pyrimidin-2-yl]-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19499067 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[4-(furan-2-yl)pyrimidin-2-yl]-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nccc(-c2ccco2)n1)c1cc(COc2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C24H17N3O3S/c28-23(27-24-25-10-9-20(26-24)21-6-3-11-29-21)22-12-16(15-31-22)14-30-19-8-7-17-4-1-2-5-18(17)13-19/h1-13,15H,14H2,(H,25,26,27,28) |
| InChIKey | HEBCUJRDBZHASS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |