C23H26N4O4 — CID 22616989
2-[[2-amino-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]amino]-N-hydroxy-2-methylpropanamide (PubChem CID 22616989) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[2-amino-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]amino]-N-hydroxy-2-methylpropanamide.
| Compound Name | 2-[[2-amino-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]amino]-N-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 22616989 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[2-amino-2-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]acetyl]amino]-N-hydroxy-2-methylpropanamide |
| SMILES | Cc1cc(COc2ccc(C(N)C(=O)NC(C)(C)C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H26N4O4/c1-14-12-16(18-6-4-5-7-19(18)25-14)13-31-17-10-8-15(9-11-17)20(24)21(28)26-23(2,3)22(29)27-30/h4-12,20,30H,13,24H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | BSCKPTDJJWCUAC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|