C28H28N2O5 — CID 10367542
N,3-dihydroxy-2-[(4-methoxyphenyl)methyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]propanamide (PubChem CID 10367542) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N,3-dihydroxy-2-[(4-methoxyphenyl)methyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]propanamide.
| Compound Name | N,3-dihydroxy-2-[(4-methoxyphenyl)methyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 10367542 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N,3-dihydroxy-2-[(4-methoxyphenyl)methyl]-3-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]propanamide |
| SMILES | COc1ccc(CC(C(=O)NO)C(O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O5/c1-18-15-21(24-5-3-4-6-26(24)29-18)17-35-23-13-9-20(10-14-23)27(31)25(28(32)30-33)16-19-7-11-22(34-2)12-8-19/h3-15,25,27,31,33H,16-17H2,1-2H3,(H,30,32) |
| InChIKey | DCSSHGKEEMIOCL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|