C30H26F3N3O6 — CID 139969315
[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 139969315) has the molecular formula C30H26F3N3O6 and a molecular weight of 581.55 g/mol. Its IUPAC name is [[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139969315 |
| Molecular Formula | C30H26F3N3O6 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(COc2ccc(C(=O)N(OC(=O)C(F)(F)F)C(CC(=O)NO)Cc3ccccc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H26F3N3O6/c1-19-15-22(25-9-5-6-10-26(25)34-19)18-41-24-13-11-21(12-14-24)28(38)36(42-29(39)30(31,32)33)23(17-27(37)35-40)16-20-7-3-2-4-8-20/h2-15,23,40H,16-18H2,1H3,(H,35,37) |
| InChIKey | VJKXTNSBKZYFTL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|