C34H36N4O6 — CID 91475428
benzyl N-[2-(hydroxyamino)-2-oxoethyl]-N-[4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]cyclohexyl]carbamate (PubChem CID 91475428) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is benzyl N-[2-(hydroxyamino)-2-oxoethyl]-N-[4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-(hydroxyamino)-2-oxoethyl]-N-[4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 91475428 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | benzyl N-[2-(hydroxyamino)-2-oxoethyl]-N-[4-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]cyclohexyl]carbamate |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3CCC(N(CC(=O)NO)C(=O)OCc4ccccc4)CC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C34H36N4O6/c1-23-19-26(30-9-5-6-10-31(30)35-23)22-43-29-17-11-25(12-18-29)33(40)36-27-13-15-28(16-14-27)38(20-32(39)37-42)34(41)44-21-24-7-3-2-4-8-24/h2-12,17-19,27-28,42H,13-16,20-22H2,1H3,(H,36,40)(H,37,39) |
| InChIKey | CIYZHQMJGOSSQJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|