C29H32N4O5 — CID 91057125
N-[4-[2-(hydroxyamino)-2-oxoethyl]-3-methyl-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 91057125) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxoethyl]-3-methyl-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]-3-methyl-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 91057125 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]-3-methyl-1-oxa-2-azaspiro[4.5]dec-3-en-8-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | CC1=C(CC(=O)NO)C2(CCC(NC(=O)c3ccc(OCc4cc(C)nc5ccccc45)cc3)CC2)ON1 |
| InChI | InChI=1S/C29H32N4O5/c1-18-15-21(24-5-3-4-6-26(24)30-18)17-37-23-9-7-20(8-10-23)28(35)31-22-11-13-29(14-12-22)25(16-27(34)32-36)19(2)33-38-29/h3-10,15,22,33,36H,11-14,16-17H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | UDXFQXBWBVRQKW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|