C39H35N3NaO5 — CID 173263599
CID 173263599 (PubChem CID 173263599) has the molecular formula C39H35N3NaO5 and a molecular weight of 648.72 g/mol.
| Compound Name | CID 173263599 |
|---|---|
| PubChem CID | 173263599 |
| Molecular Formula | C39H35N3NaO5 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | — |
| SMILES | CC(C)(CC(=NO)C(=O)O)C(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1.[Na] |
| InChI | InChI=1S/C39H35N3O5.Na/c1-39(2,23-36(42-45)38(43)44)37(28-13-19-32(20-14-28)46-24-30-17-11-26-7-3-5-9-34(26)40-30)29-15-21-33(22-16-29)47-25-31-18-12-27-8-4-6-10-35(27)41-31;/h3-22,37,45H,23-25H2,1-2H3,(H,43,44); |
| InChIKey | XWCRQUFHXBCFBV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|