About CID 173263599
CID 173263599 (PubChem CID 173263599) has the molecular formula C39H35N3NaO5
and a molecular weight of 648.72 g/mol.
Molecular Properties
| Compound Name | CID 173263599 |
| PubChem CID | 173263599 |
| Molecular Formula | C39H35N3NaO5 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | — |
| SMILES | CC(C)(CC(=NO)C(=O)O)C(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1.[Na] |
| InChI | InChI=1S/C39H35N3O5.Na/c1-39(2,23-36(42-45)38(43)44)37(28-13-19-32(20-14-28)46-24-30-17-11-26-7-3-5-9-34(26)40-30)29-15-21-33(22-16-29)47-25-31-18-12-27-8-4-6-10-35(27)41-31;/h3-22,37,45H,23-25H2,1-2H3,(H,43,44); |
| InChIKey | XWCRQUFHXBCFBV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 173263599 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173263599?
The IUPAC name of CID 173263599 (CID 173263599) is not available.
What is the SMILES notation for CID 173263599?
The canonical SMILES for CID 173263599 is CC(C)(CC(=NO)C(=O)O)C(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1.[Na].
What is the InChIKey of CID 173263599?
The InChIKey is XWCRQUFHXBCFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H35N3O5.Na/c1-39(2,23-36(42-45)38(43)44)37(28-13-19-32(20-14-28)46-24-30-17-11-26-7-3-5-9-34(26)40-30)29-15-21-33(22-16-29)47-25-31-18-12-27-8-4-6-10-35(27)41-31;/h3-22,37,45H,23-25H2,1-2H3,(H,43,44);.
What are the key properties of CID 173263599?
CID 173263599 has a molecular weight of 648.72 g/mol, XLogP of 8.02, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173263599 is sourced from PubChem (CID 173263599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).