C37H28N2O5 — CID 10579134
methyl 4-hydroxy-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]but-2-ynoate (PubChem CID 10579134) has the molecular formula C37H28N2O5 and a molecular weight of 580.64 g/mol. Its IUPAC name is methyl 4-hydroxy-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]but-2-ynoate.
| Compound Name | methyl 4-hydroxy-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]but-2-ynoate |
|---|---|
| PubChem CID | 10579134 |
| Molecular Formula | C37H28N2O5 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | methyl 4-hydroxy-4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]but-2-ynoate |
| SMILES | COC(=O)C#CC(O)(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C37H28N2O5/c1-42-36(40)22-23-37(41,28-12-18-32(19-13-28)43-24-30-16-10-26-6-2-4-8-34(26)38-30)29-14-20-33(21-15-29)44-25-31-17-11-27-7-3-5-9-35(27)39-31/h2-21,41H,24-25H2,1H3 |
| InChIKey | PGIOLHYERFEYKM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|