C33H25N4NaO4 — CID 23681324
sodium 4,4-bis(4-quinoxalin-2-yloxyphenyl)pentanoate (PubChem CID 23681324) has the molecular formula C33H25N4NaO4 and a molecular weight of 564.58 g/mol. Its IUPAC name is sodium 4,4-bis(4-quinoxalin-2-yloxyphenyl)pentanoate.
| Compound Name | sodium 4,4-bis(4-quinoxalin-2-yloxyphenyl)pentanoate |
|---|---|
| PubChem CID | 23681324 |
| Molecular Formula | C33H25N4NaO4 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | sodium 4,4-bis(4-quinoxalin-2-yloxyphenyl)pentanoate |
| SMILES | CC(CCC(=O)[O-])(c1ccc(Oc2cnc3ccccc3n2)cc1)c1ccc(Oc2cnc3ccccc3n2)cc1.[Na+] |
| InChI | InChI=1S/C33H26N4O4.Na/c1-33(19-18-32(38)39,22-10-14-24(15-11-22)40-30-20-34-26-6-2-4-8-28(26)36-30)23-12-16-25(17-13-23)41-31-21-35-27-7-3-5-9-29(27)37-31;/h2-17,20-21H,18-19H2,1H3,(H,38,39);/q;+1/p-1 |
| InChIKey | HKARHOQOIPJIRP-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 110.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |