(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate

C22H15ClN2O3 — CID 175252709

IUPAC(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate
SMILESO=C(OCc1ccc(Cl)cc1)c1ccc(Oc2cnc3ccccc3n2)cc1
InChIInChI=1S/C22H15ClN2O3/c23-17-9-5-15(6-10-17)14-27-22(26)16-7-11-18(12-8-16)28-21-13-24-19-3-1-2-4-20(19)25-21/h1-13H,14H2
InChIKeyJXRVRFYKYBLGHA-UHFFFAOYSA-N
MW390.83 g/mol
LogP5.43
Rot. Bonds5

About (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate

(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate (PubChem CID 175252709) has the molecular formula C22H15ClN2O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate
PubChem CID175252709
Molecular FormulaC22H15ClN2O3
Molecular Weight390.83 g/mol
Exact Mass390.08
IUPAC Name(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate
SMILESO=C(OCc1ccc(Cl)cc1)c1ccc(Oc2cnc3ccccc3n2)cc1
InChIInChI=1S/C22H15ClN2O3/c23-17-9-5-15(6-10-17)14-27-22(26)16-7-11-18(12-8-16)28-21-13-24-19-3-1-2-4-20(19)25-21/h1-13H,14H2
InChIKeyJXRVRFYKYBLGHA-UHFFFAOYSA-N
XLogP5.43
TPSA61.31 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500390.83
LogP ≤ 55.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate?
The IUPAC name of (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate (CID 175252709) is (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate.
What is the SMILES notation for (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate?
The canonical SMILES for (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate is O=C(OCc1ccc(Cl)cc1)c1ccc(Oc2cnc3ccccc3n2)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate?
The InChIKey is JXRVRFYKYBLGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClN2O3/c23-17-9-5-15(6-10-17)14-27-22(26)16-7-11-18(12-8-16)28-21-13-24-19-3-1-2-4-20(19)25-21/h1-13H,14H2.
What are the key properties of (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate?
(4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate has a molecular weight of 390.83 g/mol, XLogP of 5.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 4-quinoxalin-2-yloxybenzoate is sourced from PubChem (CID 175252709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).