About quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate
quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate (PubChem CID 10832034) has the molecular formula C23H17NO3
and a molecular weight of 355.39 g/mol. Its IUPAC name is quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate.
Molecular Properties
| Compound Name | quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate |
| PubChem CID | 10832034 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate |
| SMILES | O=C(OCc1cnc2ccccc2c1)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H17NO3/c25-21-11-9-18(10-12-21)17-5-7-19(8-6-17)23(26)27-15-16-13-20-3-1-2-4-22(20)24-14-16/h1-14,25H,15H2 |
| InChIKey | RPZHUPCEOKIMIJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate?
The IUPAC name of quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate (CID 10832034) is quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate.
What is the SMILES notation for quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate?
The canonical SMILES for quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate is O=C(OCc1cnc2ccccc2c1)c1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate?
The InChIKey is RPZHUPCEOKIMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO3/c25-21-11-9-18(10-12-21)17-5-7-19(8-6-17)23(26)27-15-16-13-20-3-1-2-4-22(20)24-14-16/h1-14,25H,15H2.
What are the key properties of quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate?
quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate has a molecular weight of 355.39 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-3-ylmethyl 4-(4-hydroxyphenyl)benzoate is sourced from PubChem (CID 10832034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).