C13H14N2O4S2 — CID 139325238
2-(quinolin-3-ylmethoxycarbothioylamino)ethanesulfonic acid (PubChem CID 139325238) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(quinolin-3-ylmethoxycarbothioylamino)ethanesulfonic acid.
| Compound Name | 2-(quinolin-3-ylmethoxycarbothioylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 139325238 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(quinolin-3-ylmethoxycarbothioylamino)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCNC(=S)OCc1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H14N2O4S2/c16-21(17,18)6-5-14-13(20)19-9-10-7-11-3-1-2-4-12(11)15-8-10/h1-4,7-8H,5-6,9H2,(H,14,20)(H,16,17,18) |
| InChIKey | DTXDBYRTFBIXNY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|