C15H22N2O4S — CID 142246156
hydroxylamine;3-[[(3R)-3-methoxybutyl]sulfonylmethyl]quinoline (PubChem CID 142246156) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is hydroxylamine;3-[[(3R)-3-methoxybutyl]sulfonylmethyl]quinoline.
| Compound Name | hydroxylamine;3-[[(3R)-3-methoxybutyl]sulfonylmethyl]quinoline |
|---|---|
| PubChem CID | 142246156 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | hydroxylamine;3-[[(3R)-3-methoxybutyl]sulfonylmethyl]quinoline |
| SMILES | CO[C@H](C)CCS(=O)(=O)Cc1cnc2ccccc2c1.NO |
| InChI | InChI=1S/C15H19NO3S.H3NO/c1-12(19-2)7-8-20(17,18)11-13-9-14-5-3-4-6-15(14)16-10-13;1-2/h3-6,9-10,12H,7-8,11H2,1-2H3;2H,1H2/t12-;/m1./s1 |
| InChIKey | DKJLVLSGYPESCJ-UTONKHPSSA-N |
| XLogP | 1.91 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|