C18H25NO2S — CID 142246181
6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane (PubChem CID 142246181) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane.
| Compound Name | 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane |
|---|---|
| PubChem CID | 142246181 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane |
| SMILES | C=S(=O)(CCCCCCOC)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H25NO2S/c1-21-11-7-3-4-8-12-22(2,20)15-16-13-17-9-5-6-10-18(17)19-14-16/h5-6,9-10,13-14H,2-4,7-8,11-12,15H2,1H3 |
| InChIKey | FSXQNYNDBJCLOV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|