About 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane
6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane (PubChem CID 142246181) has the molecular formula C18H25NO2S
and a molecular weight of 319.47 g/mol. Its IUPAC name is 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane.
Molecular Properties
| Compound Name | 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane |
| PubChem CID | 142246181 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane |
| SMILES | C=S(=O)(CCCCCCOC)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H25NO2S/c1-21-11-7-3-4-8-12-22(2,20)15-16-13-17-9-5-6-10-18(17)19-14-16/h5-6,9-10,13-14H,2-4,7-8,11-12,15H2,1H3 |
| InChIKey | FSXQNYNDBJCLOV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane?
The IUPAC name of 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane (CID 142246181) is 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane.
What is the SMILES notation for 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane?
The canonical SMILES for 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane is C=S(=O)(CCCCCCOC)Cc1cnc2ccccc2c1.
What is the InChIKey of 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane?
The InChIKey is FSXQNYNDBJCLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2S/c1-21-11-7-3-4-8-12-22(2,20)15-16-13-17-9-5-6-10-18(17)19-14-16/h5-6,9-10,13-14H,2-4,7-8,11-12,15H2,1H3.
What are the key properties of 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane?
6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane has a molecular weight of 319.47 g/mol, XLogP of 3.66, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyhexyl-methylidene-oxo-(quinolin-3-ylmethyl)-λ6-sulfane is sourced from PubChem (CID 142246181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).