About methanamine;3-methoxypropane-1-sulfonic acid;quinoline
methanamine;3-methoxypropane-1-sulfonic acid;quinoline (PubChem CID 158749423) has the molecular formula C14H22N2O4S
and a molecular weight of 314.41 g/mol. Its IUPAC name is methanamine;3-methoxypropane-1-sulfonic acid;quinoline.
Molecular Properties
| Compound Name | methanamine;3-methoxypropane-1-sulfonic acid;quinoline |
| PubChem CID | 158749423 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methanamine;3-methoxypropane-1-sulfonic acid;quinoline |
| SMILES | CN.COCCCS(=O)(=O)O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C4H10O4S.CH5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-3-2-4-9(5,6)7;1-2/h1-7H;2-4H2,1H3,(H,5,6,7);2H2,1H3 |
| InChIKey | INHCAAKLTOWDOT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;3-methoxypropane-1-sulfonic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-methoxypropane-1-sulfonic acid;quinoline?
The IUPAC name of methanamine;3-methoxypropane-1-sulfonic acid;quinoline (CID 158749423) is methanamine;3-methoxypropane-1-sulfonic acid;quinoline.
What is the SMILES notation for methanamine;3-methoxypropane-1-sulfonic acid;quinoline?
The canonical SMILES for methanamine;3-methoxypropane-1-sulfonic acid;quinoline is CN.COCCCS(=O)(=O)O.c1ccc2ncccc2c1.
What is the InChIKey of methanamine;3-methoxypropane-1-sulfonic acid;quinoline?
The InChIKey is INHCAAKLTOWDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H10O4S.CH5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-3-2-4-9(5,6)7;1-2/h1-7H;2-4H2,1H3,(H,5,6,7);2H2,1H3.
What are the key properties of methanamine;3-methoxypropane-1-sulfonic acid;quinoline?
methanamine;3-methoxypropane-1-sulfonic acid;quinoline has a molecular weight of 314.41 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-methoxypropane-1-sulfonic acid;quinoline is sourced from PubChem (CID 158749423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).