About 2-oxopropyl hydrogen sulfate;quinoline
2-oxopropyl hydrogen sulfate;quinoline (PubChem CID 174602490) has the molecular formula C12H13NO5S
and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-oxopropyl hydrogen sulfate;quinoline.
Molecular Properties
| Compound Name | 2-oxopropyl hydrogen sulfate;quinoline |
| PubChem CID | 174602490 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-oxopropyl hydrogen sulfate;quinoline |
| SMILES | CC(=O)COS(=O)(=O)O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H6O5S/c1-2-6-9-8(4-1)5-3-7-10-9;1-3(4)2-8-9(5,6)7/h1-7H;2H2,1H3,(H,5,6,7) |
| InChIKey | UVRVBVMYRZIVKB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl hydrogen sulfate;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl hydrogen sulfate;quinoline?
The IUPAC name of 2-oxopropyl hydrogen sulfate;quinoline (CID 174602490) is 2-oxopropyl hydrogen sulfate;quinoline.
What is the SMILES notation for 2-oxopropyl hydrogen sulfate;quinoline?
The canonical SMILES for 2-oxopropyl hydrogen sulfate;quinoline is CC(=O)COS(=O)(=O)O.c1ccc2ncccc2c1.
What is the InChIKey of 2-oxopropyl hydrogen sulfate;quinoline?
The InChIKey is UVRVBVMYRZIVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H6O5S/c1-2-6-9-8(4-1)5-3-7-10-9;1-3(4)2-8-9(5,6)7/h1-7H;2H2,1H3,(H,5,6,7).
What are the key properties of 2-oxopropyl hydrogen sulfate;quinoline?
2-oxopropyl hydrogen sulfate;quinoline has a molecular weight of 283.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl hydrogen sulfate;quinoline is sourced from PubChem (CID 174602490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).