C16H21N2O5P — CID 134463947
dimethyl 3-[(2-quinolin-3-ylacetyl)amino]propyl phosphate (PubChem CID 134463947) has the molecular formula C16H21N2O5P and a molecular weight of 352.33 g/mol. Its IUPAC name is dimethyl 3-[(2-quinolin-3-ylacetyl)amino]propyl phosphate.
| Compound Name | dimethyl 3-[(2-quinolin-3-ylacetyl)amino]propyl phosphate |
|---|---|
| PubChem CID | 134463947 |
| Molecular Formula | C16H21N2O5P |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | dimethyl 3-[(2-quinolin-3-ylacetyl)amino]propyl phosphate |
| SMILES | COP(=O)(OC)OCCCNC(=O)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H21N2O5P/c1-21-24(20,22-2)23-9-5-8-17-16(19)11-13-10-14-6-3-4-7-15(14)18-12-13/h3-4,6-7,10,12H,5,8-9,11H2,1-2H3,(H,17,19) |
| InChIKey | VVTZMFFLXCSQAN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|