C12H12NO5P — CID 167094714
(2-oxo-3-quinolin-3-ylpropyl) dihydrogen phosphate (PubChem CID 167094714) has the molecular formula C12H12NO5P and a molecular weight of 281.20 g/mol. Its IUPAC name is (2-oxo-3-quinolin-3-ylpropyl) dihydrogen phosphate.
| Compound Name | (2-oxo-3-quinolin-3-ylpropyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 167094714 |
| Molecular Formula | C12H12NO5P |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (2-oxo-3-quinolin-3-ylpropyl) dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C12H12NO5P/c14-11(8-18-19(15,16)17)6-9-5-10-3-1-2-4-12(10)13-7-9/h1-5,7H,6,8H2,(H2,15,16,17) |
| InChIKey | CNAYPJKELUPDMQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|