About ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane
ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane (PubChem CID 142246165) has the molecular formula C20H33NOS
and a molecular weight of 335.56 g/mol. Its IUPAC name is ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane.
Molecular Properties
| Compound Name | ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane |
| PubChem CID | 142246165 |
| Molecular Formula | C20H33NOS |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane |
| SMILES | CC.CCC.CO[C@H](C)CCSCc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H19NOS.C3H8.C2H6/c1-12(17-2)7-8-18-11-13-9-14-5-3-4-6-15(14)16-10-13;1-3-2;1-2/h3-6,9-10,12H,7-8,11H2,1-2H3;3H2,1-2H3;1-2H3/t12-;;/m1../s1 |
| InChIKey | WZLKTVHWYHJIID-CURYUGHLSA-N |
| XLogP | 6.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane?
The IUPAC name of ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane (CID 142246165) is ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane.
What is the SMILES notation for ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane?
The canonical SMILES for ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane is CC.CCC.CO[C@H](C)CCSCc1cnc2ccccc2c1.
What is the InChIKey of ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane?
The InChIKey is WZLKTVHWYHJIID-CURYUGHLSA-N. The full InChI is InChI=1S/C15H19NOS.C3H8.C2H6/c1-12(17-2)7-8-18-11-13-9-14-5-3-4-6-15(14)16-10-13;1-3-2;1-2/h3-6,9-10,12H,7-8,11H2,1-2H3;3H2,1-2H3;1-2H3/t12-;;/m1../s1.
What are the key properties of ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane?
ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane has a molecular weight of 335.56 g/mol, XLogP of 6.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[[(3R)-3-methoxybutyl]sulfanylmethyl]quinoline;propane is sourced from PubChem (CID 142246165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).