C16H19NOS — CID 154803450
3,3-dimethyl-1-(quinolin-3-ylmethylsulfanyl)butan-2-one (PubChem CID 154803450) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-(quinolin-3-ylmethylsulfanyl)butan-2-one.
| Compound Name | 3,3-dimethyl-1-(quinolin-3-ylmethylsulfanyl)butan-2-one |
|---|---|
| PubChem CID | 154803450 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3,3-dimethyl-1-(quinolin-3-ylmethylsulfanyl)butan-2-one |
| SMILES | CC(C)(C)C(=O)CSCc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H19NOS/c1-16(2,3)15(18)11-19-10-12-8-13-6-4-5-7-14(13)17-9-12/h4-9H,10-11H2,1-3H3 |
| InChIKey | JPWKZQPTJTXRFT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |