C13H14N2O2S — CID 114203513
(2S)-2-amino-3-(quinolin-3-ylmethylsulfanyl)propanoic acid (PubChem CID 114203513) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is (2S)-2-amino-3-(quinolin-3-ylmethylsulfanyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(quinolin-3-ylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 114203513 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2S)-2-amino-3-(quinolin-3-ylmethylsulfanyl)propanoic acid |
| SMILES | N[C@H](CSCc1cnc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C13H14N2O2S/c14-11(13(16)17)8-18-7-9-5-10-3-1-2-4-12(10)15-6-9/h1-6,11H,7-8,14H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | QPQLSWMFWUYUDP-LLVKDONJSA-N |
| XLogP | 1.88 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |