C16H19NOS — CID 142246183
3-[2-(oxolan-2-yl)ethylsulfanylmethyl]quinoline (PubChem CID 142246183) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 3-[2-(oxolan-2-yl)ethylsulfanylmethyl]quinoline.
| Compound Name | 3-[2-(oxolan-2-yl)ethylsulfanylmethyl]quinoline |
|---|---|
| PubChem CID | 142246183 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[2-(oxolan-2-yl)ethylsulfanylmethyl]quinoline |
| SMILES | c1ccc2ncc(CSCCC3CCCO3)cc2c1 |
| InChI | InChI=1S/C16H19NOS/c1-2-6-16-14(4-1)10-13(11-17-16)12-19-9-7-15-5-3-8-18-15/h1-2,4,6,10-11,15H,3,5,7-9,12H2 |
| InChIKey | WQLIZKSVVFPTKI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|