C17H19NO2 — CID 114963138
3-(oxan-2-yl)-1-quinolin-3-ylpropan-1-one (PubChem CID 114963138) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(oxan-2-yl)-1-quinolin-3-ylpropan-1-one.
| Compound Name | 3-(oxan-2-yl)-1-quinolin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 114963138 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(oxan-2-yl)-1-quinolin-3-ylpropan-1-one |
| SMILES | O=C(CCC1CCCCO1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO2/c19-17(9-8-15-6-3-4-10-20-15)14-11-13-5-1-2-7-16(13)18-12-14/h1-2,5,7,11-12,15H,3-4,6,8-10H2 |
| InChIKey | GWEAOGXDSJWDJW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |