C9H14N2O3S — CID 140565025
4-hydroxy-4-pyridin-2-ylbutane-2-sulfonamide (PubChem CID 140565025) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-hydroxy-4-pyridin-2-ylbutane-2-sulfonamide.
| Compound Name | 4-hydroxy-4-pyridin-2-ylbutane-2-sulfonamide |
|---|---|
| PubChem CID | 140565025 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-hydroxy-4-pyridin-2-ylbutane-2-sulfonamide |
| SMILES | CC(CC(O)c1ccccn1)S(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O3S/c1-7(15(10,13)14)6-9(12)8-4-2-3-5-11-8/h2-5,7,9,12H,6H2,1H3,(H2,10,13,14) |
| InChIKey | PFBVNQFUWROZEU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |