C12H20ClN3O3S — CID 68998550
4-amino-6-methyl-1-pyridin-2-ylsulfonylazepan-3-ol;hydrochloride (PubChem CID 68998550) has the molecular formula C12H20ClN3O3S and a molecular weight of 321.83 g/mol. Its IUPAC name is 4-amino-6-methyl-1-pyridin-2-ylsulfonylazepan-3-ol;hydrochloride.
| Compound Name | 4-amino-6-methyl-1-pyridin-2-ylsulfonylazepan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 68998550 |
| Molecular Formula | C12H20ClN3O3S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-amino-6-methyl-1-pyridin-2-ylsulfonylazepan-3-ol;hydrochloride |
| SMILES | CC1CC(N)C(O)CN(S(=O)(=O)c2ccccn2)C1.Cl |
| InChI | InChI=1S/C12H19N3O3S.ClH/c1-9-6-10(13)11(16)8-15(7-9)19(17,18)12-4-2-3-5-14-12;/h2-5,9-11,16H,6-8,13H2,1H3;1H |
| InChIKey | LZZOVHKZBWOBND-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |