C25H33N3O3S — CID 41071233
N-cyclohexyl-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-pyridin-2-ylbenzamide (PubChem CID 41071233) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is N-cyclohexyl-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-pyridin-2-ylbenzamide.
| Compound Name | N-cyclohexyl-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 41071233 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-cyclohexyl-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-N-pyridin-2-ylbenzamide |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)N(c3ccccn3)C3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C25H33N3O3S/c1-19-16-20(2)18-27(17-19)32(30,31)23-13-11-21(12-14-23)25(29)28(22-8-4-3-5-9-22)24-10-6-7-15-26-24/h6-7,10-15,19-20,22H,3-5,8-9,16-18H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | NOLQDDIQUIABEL-PMACEKPBSA-N |
| XLogP | 4.73 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |