C16H25N3O4S — CID 141047356
N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide (PubChem CID 141047356) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide.
| Compound Name | N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide |
|---|---|
| PubChem CID | 141047356 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)pentanamide |
| SMILES | CCCCC(=O)NC1CCCN(S(=O)(=O)c2ccccn2)CC1O |
| InChI | InChI=1S/C16H25N3O4S/c1-2-3-8-15(21)18-13-7-6-11-19(12-14(13)20)24(22,23)16-9-4-5-10-17-16/h4-5,9-10,13-14,20H,2-3,6-8,11-12H2,1H3,(H,18,21) |
| InChIKey | RMOHCVPVJSGIBR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |