C17H28N4O4S — CID 69310541
(2S)-2-amino-N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)-3-methylpentanamide (PubChem CID 69310541) has the molecular formula C17H28N4O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)-3-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 69310541 |
| Molecular Formula | C17H28N4O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-2-amino-N-(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)-3-methylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)NC1CCCN(S(=O)(=O)c2ccccn2)CC1O |
| InChI | InChI=1S/C17H28N4O4S/c1-3-12(2)16(18)17(23)20-13-7-6-10-21(11-14(13)22)26(24,25)15-8-4-5-9-19-15/h4-5,8-9,12-14,16,22H,3,6-7,10-11,18H2,1-2H3,(H,20,23)/t12?,13?,14?,16-/m0/s1 |
| InChIKey | VCHMKTQVOJUNCV-OXCCAUKLSA-N |
| XLogP | 0.09 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |