C26H32N4O6S — CID 131726980
N-[(2S)-1-[(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)amino]-3-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 131726980) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is N-[(2S)-1-[(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)amino]-3-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-1-[(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)amino]-3-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 131726980 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | N-[(2S)-1-[(3-hydroxy-1-pyridin-2-ylsulfonylazepan-4-yl)amino]-3-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | CCC(C)[C@H](NC(=O)c1cc2ccccc2o1)C(=O)NC1CCCN(S(=O)(=O)c2ccccn2)CC1O |
| InChI | InChI=1S/C26H32N4O6S/c1-3-17(2)24(29-25(32)22-15-18-9-4-5-11-21(18)36-22)26(33)28-19-10-8-14-30(16-20(19)31)37(34,35)23-12-6-7-13-27-23/h4-7,9,11-13,15,17,19-20,24,31H,3,8,10,14,16H2,1-2H3,(H,28,33)(H,29,32)/t17?,19?,20?,24-/m0/s1 |
| InChIKey | DGEDXVLSKVAGOU-TZSXHWLRSA-N |
| XLogP | 2.30 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |