C28H35N3O7S — CID 56981089
N-[1-[[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 56981089) has the molecular formula C28H35N3O7S and a molecular weight of 557.67 g/mol. Its IUPAC name is N-[1-[[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 56981089 |
| Molecular Formula | C28H35N3O7S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | N-[1-[[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc(S(=O)(=O)N2CCCC(NC(=O)C(CC(C)C)NC(=O)c3cc4ccccc4o3)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C28H35N3O7S/c1-18(2)14-23(30-28(34)26-15-19-8-4-5-12-25(19)38-26)27(33)29-22-11-7-13-31(17-24(22)32)39(35,36)21-10-6-9-20(16-21)37-3/h4-6,8-10,12,15-16,18,22-24,32H,7,11,13-14,17H2,1-3H3,(H,29,33)(H,30,34)/t22?,23?,24-/m0/s1 |
| InChIKey | KDSLNCYBKBWMSE-VHYCJAOWSA-N |
| XLogP | 2.92 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |