C19H31N3O5S — CID 54188592
2-amino-N-[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]-4-methylpentanamide (PubChem CID 54188592) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-amino-N-[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 54188592 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-amino-N-[(3S)-3-hydroxy-1-(3-methoxyphenyl)sulfonylazepan-4-yl]-4-methylpentanamide |
| SMILES | COc1cccc(S(=O)(=O)N2CCCC(NC(=O)C(N)CC(C)C)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C19H31N3O5S/c1-13(2)10-16(20)19(24)21-17-8-5-9-22(12-18(17)23)28(25,26)15-7-4-6-14(11-15)27-3/h4,6-7,11,13,16-18,23H,5,8-10,12,20H2,1-3H3,(H,21,24)/t16?,17?,18-/m0/s1 |
| InChIKey | PGWRSJUGPQLILK-ABHNRTSZSA-N |
| XLogP | 0.70 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |