C19H29N3O7S — CID 173158507
N'-[(3S)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxyazepan-4-yl]pentanediamide (PubChem CID 173158507) has the molecular formula C19H29N3O7S and a molecular weight of 443.52 g/mol. Its IUPAC name is N'-[(3S)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxyazepan-4-yl]pentanediamide.
| Compound Name | N'-[(3S)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxyazepan-4-yl]pentanediamide |
|---|---|
| PubChem CID | 173158507 |
| Molecular Formula | C19H29N3O7S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N'-[(3S)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxyazepan-4-yl]pentanediamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(NC(=O)CCCC(N)=O)[C@@H](O)C2)cc1OC |
| InChI | InChI=1S/C19H29N3O7S/c1-28-16-9-8-13(11-17(16)29-2)30(26,27)22-10-4-5-14(15(23)12-22)21-19(25)7-3-6-18(20)24/h8-9,11,14-15,23H,3-7,10,12H2,1-2H3,(H2,20,24)(H,21,25)/t14?,15-/m0/s1 |
| InChIKey | RVWHNXCRESDEKB-LOACHALJSA-N |
| XLogP | -0.01 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |