C13H19N3O2S2 — CID 106596381
3-(3,5-dimethylpiperidin-1-yl)sulfonylpyridine-2-carbothioamide (PubChem CID 106596381) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonylpyridine-2-carbothioamide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonylpyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106596381 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonylpyridine-2-carbothioamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccnc2C(N)=S)C1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-9-6-10(2)8-16(7-9)20(17,18)11-4-3-5-15-12(11)13(14)19/h3-5,9-10H,6-8H2,1-2H3,(H2,14,19) |
| InChIKey | KYQJETVLZAYRII-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|