C17H22FN3O7S2 — CID 166728839
5-[[(2R)-2-cyclopropyl-1,4-diazepan-1-yl]sulfonyl]-4-fluoro-2H-isoquinolin-1-one;sulfuric acid (PubChem CID 166728839) has the molecular formula C17H22FN3O7S2 and a molecular weight of 463.51 g/mol. Its IUPAC name is 5-[[(2R)-2-cyclopropyl-1,4-diazepan-1-yl]sulfonyl]-4-fluoro-2H-isoquinolin-1-one;sulfuric acid.
| Compound Name | 5-[[(2R)-2-cyclopropyl-1,4-diazepan-1-yl]sulfonyl]-4-fluoro-2H-isoquinolin-1-one;sulfuric acid |
|---|---|
| PubChem CID | 166728839 |
| Molecular Formula | C17H22FN3O7S2 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 5-[[(2R)-2-cyclopropyl-1,4-diazepan-1-yl]sulfonyl]-4-fluoro-2H-isoquinolin-1-one;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=c1[nH]cc(F)c2c(S(=O)(=O)N3CCCNC[C@H]3C3CC3)cccc12 |
| InChI | InChI=1S/C17H20FN3O3S.H2O4S/c18-13-9-20-17(22)12-3-1-4-15(16(12)13)25(23,24)21-8-2-7-19-10-14(21)11-5-6-11;1-5(2,3)4/h1,3-4,9,11,14,19H,2,5-8,10H2,(H,20,22);(H2,1,2,3,4)/t14-;/m0./s1 |
| InChIKey | YUVYNGVNCLSUQJ-UQKRIMTDSA-N |
| XLogP | 0.78 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|