C19H25N3O5S — CID 166728844
4-cyclopropyl-5-[[(2R)-2-methyl-1,4-diazepan-1-yl]sulfonyl]-2H-isoquinolin-1-one;formic acid (PubChem CID 166728844) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-cyclopropyl-5-[[(2R)-2-methyl-1,4-diazepan-1-yl]sulfonyl]-2H-isoquinolin-1-one;formic acid.
| Compound Name | 4-cyclopropyl-5-[[(2R)-2-methyl-1,4-diazepan-1-yl]sulfonyl]-2H-isoquinolin-1-one;formic acid |
|---|---|
| PubChem CID | 166728844 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-cyclopropyl-5-[[(2R)-2-methyl-1,4-diazepan-1-yl]sulfonyl]-2H-isoquinolin-1-one;formic acid |
| SMILES | C[C@@H]1CNCCCN1S(=O)(=O)c1cccc2c(=O)[nH]cc(C3CC3)c12.O=CO |
| InChI | InChI=1S/C18H23N3O3S.CH2O2/c1-12-10-19-8-3-9-21(12)25(23,24)16-5-2-4-14-17(16)15(13-6-7-13)11-20-18(14)22;2-1-3/h2,4-5,11-13,19H,3,6-10H2,1H3,(H,20,22);1H,(H,2,3)/t12-;/m1./s1 |
| InChIKey | KOKTUQUYMMAIDI-UTONKHPSSA-N |
| XLogP | 1.48 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|