C17H21N3O4S — CID 22121972
5-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]-4-methyl-2H-isoquinolin-1-one (PubChem CID 22121972) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]-4-methyl-2H-isoquinolin-1-one.
| Compound Name | 5-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]-4-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 22121972 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]-4-methyl-2H-isoquinolin-1-one |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2cccc3c(=O)[nH]cc(C)c23)CC1 |
| InChI | InChI=1S/C17H21N3O4S/c1-12-11-18-17(22)14-5-3-6-15(16(12)14)25(23,24)20-8-4-7-19(9-10-20)13(2)21/h3,5-6,11H,4,7-10H2,1-2H3,(H,18,22) |
| InChIKey | QIBSTCZPFARYGG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |