C19H22N2O4S — CID 110799321
phenyl 4-(2-methylphenyl)sulfonyl-1,4-diazepane-1-carboxylate (PubChem CID 110799321) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is phenyl 4-(2-methylphenyl)sulfonyl-1,4-diazepane-1-carboxylate.
| Compound Name | phenyl 4-(2-methylphenyl)sulfonyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110799321 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | phenyl 4-(2-methylphenyl)sulfonyl-1,4-diazepane-1-carboxylate |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCCN(C(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2O4S/c1-16-8-5-6-11-18(16)26(23,24)21-13-7-12-20(14-15-21)19(22)25-17-9-3-2-4-10-17/h2-6,8-11H,7,12-15H2,1H3 |
| InChIKey | QRCUHPPTKGRTNG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |