C18H22FN2O2PS — CID 143369481
1-[4-(4-fluoro-2-phosphanylphenyl)phenyl]sulfonyl-N,N-dimethylpyrrolidin-3-amine (PubChem CID 143369481) has the molecular formula C18H22FN2O2PS and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-[4-(4-fluoro-2-phosphanylphenyl)phenyl]sulfonyl-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[4-(4-fluoro-2-phosphanylphenyl)phenyl]sulfonyl-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 143369481 |
| Molecular Formula | C18H22FN2O2PS |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-(4-fluoro-2-phosphanylphenyl)phenyl]sulfonyl-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3P)cc2)C1 |
| InChI | InChI=1S/C18H22FN2O2PS/c1-20(2)15-9-10-21(12-15)25(22,23)16-6-3-13(4-7-16)17-8-5-14(19)11-18(17)24/h3-8,11,15H,9-10,12,24H2,1-2H3 |
| InChIKey | ZPAOFUJUEBTVNT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|