C20H25N3O2 — CID 25455767
[(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-(1-oxidopyridin-1-ium-3-yl)methanone (PubChem CID 25455767) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-(1-oxidopyridin-1-ium-3-yl)methanone.
| Compound Name | [(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 25455767 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
| SMILES | CN(CCc1ccccc1)[C@@H]1CCCN(C(=O)c2ccc[n+]([O-])c2)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-21(14-11-17-7-3-2-4-8-17)19-10-6-12-22(16-19)20(24)18-9-5-13-23(25)15-18/h2-5,7-9,13,15,19H,6,10-12,14,16H2,1H3/t19-/m1/s1 |
| InChIKey | ZGIQHYCMYIVSQA-LJQANCHMSA-N |
| XLogP | 2.10 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|