C18H18F2N2O2 — CID 95551911
(3R)-3-[(4-fluorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-3-carboxylic acid (PubChem CID 95551911) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is (3R)-3-[(4-fluorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-[(4-fluorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95551911 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3R)-3-[(4-fluorophenyl)methyl]-1-(3-fluoro-2-pyridinyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@]1(Cc2ccc(F)cc2)CCCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C18H18F2N2O2/c19-14-6-4-13(5-7-14)11-18(17(23)24)8-2-10-22(12-18)16-15(20)3-1-9-21-16/h1,3-7,9H,2,8,10-12H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | OOVBRWMAKAASFH-GOSISDBHSA-N |
| XLogP | 3.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |