C17H18FN3O2 — CID 95220617
(3R)-3-[(2-fluorophenyl)methyl]-1-pyrazin-2-ylpiperidine-3-carboxylic acid (PubChem CID 95220617) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is (3R)-3-[(2-fluorophenyl)methyl]-1-pyrazin-2-ylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-3-[(2-fluorophenyl)methyl]-1-pyrazin-2-ylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95220617 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (3R)-3-[(2-fluorophenyl)methyl]-1-pyrazin-2-ylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@]1(Cc2ccccc2F)CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C17H18FN3O2/c18-14-5-2-1-4-13(14)10-17(16(22)23)6-3-9-21(12-17)15-11-19-7-8-20-15/h1-2,4-5,7-8,11H,3,6,9-10,12H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | BJWPVOFAOSTAIO-QGZVFWFLSA-N |
| XLogP | 2.53 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |