C19H23N3O2 — CID 95549718
(3S)-3-[(2-methylphenyl)methyl]-1-(6-methylpyridazin-3-yl)piperidine-3-carboxylic acid (PubChem CID 95549718) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3S)-3-[(2-methylphenyl)methyl]-1-(6-methylpyridazin-3-yl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-3-[(2-methylphenyl)methyl]-1-(6-methylpyridazin-3-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95549718 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (3S)-3-[(2-methylphenyl)methyl]-1-(6-methylpyridazin-3-yl)piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(N2CCC[C@@](Cc3ccccc3C)(C(=O)O)C2)nn1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-6-3-4-7-16(14)12-19(18(23)24)10-5-11-22(13-19)17-9-8-15(2)20-21-17/h3-4,6-9H,5,10-13H2,1-2H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | FWSNMIIVAVJSHH-IBGZPJMESA-N |
| XLogP | 3.01 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |