C13H15FO3 — CID 55149955
3-[(2-fluorophenyl)methyl]oxane-3-carboxylic acid (PubChem CID 55149955) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[(2-fluorophenyl)methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 55149955 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccccc2F)CCCOC1 |
| InChI | InChI=1S/C13H15FO3/c14-11-5-2-1-4-10(11)8-13(12(15)16)6-3-7-17-9-13/h1-2,4-5H,3,6-9H2,(H,15,16) |
| InChIKey | XMGGEPUXLWSOCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |