3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid

C13H14Cl2O3 — CID 55150319

IUPAC3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid
SMILESO=C(O)C1(Cc2ccc(Cl)c(Cl)c2)CCCOC1
InChIInChI=1S/C13H14Cl2O3/c14-10-3-2-9(6-11(10)15)7-13(12(16)17)4-1-5-18-8-13/h2-3,6H,1,4-5,7-8H2,(H,16,17)
InChIKeyYLKXWELLPJCKDB-UHFFFAOYSA-N
MW289.16 g/mol
LogP3.42
Rot. Bonds3

About 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid

3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid (PubChem CID 55150319) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid.

Molecular Properties

Compound Name3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid
PubChem CID55150319
Molecular FormulaC13H14Cl2O3
Molecular Weight289.16 g/mol
Exact Mass288.03
IUPAC Name3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid
SMILESO=C(O)C1(Cc2ccc(Cl)c(Cl)c2)CCCOC1
InChIInChI=1S/C13H14Cl2O3/c14-10-3-2-9(6-11(10)15)7-13(12(16)17)4-1-5-18-8-13/h2-3,6H,1,4-5,7-8H2,(H,16,17)
InChIKeyYLKXWELLPJCKDB-UHFFFAOYSA-N
XLogP3.42
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.16
LogP ≤ 53.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid?
The IUPAC name of 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid (CID 55150319) is 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid is O=C(O)C1(Cc2ccc(Cl)c(Cl)c2)CCCOC1.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid?
The InChIKey is YLKXWELLPJCKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O3/c14-10-3-2-9(6-11(10)15)7-13(12(16)17)4-1-5-18-8-13/h2-3,6H,1,4-5,7-8H2,(H,16,17).
What are the key properties of 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid?
3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid has a molecular weight of 289.16 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid is sourced from PubChem (CID 55150319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).