C13H14Cl2O3 — CID 55150319
3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid (PubChem CID 55150319) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 55150319 |
| Molecular Formula | C13H14Cl2O3 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Cl)c(Cl)c2)CCCOC1 |
| InChI | InChI=1S/C13H14Cl2O3/c14-10-3-2-9(6-11(10)15)7-13(12(16)17)4-1-5-18-8-13/h2-3,6H,1,4-5,7-8H2,(H,16,17) |
| InChIKey | YLKXWELLPJCKDB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |